C16H19N3O2 — CID 82192903
3-[[4-(4-ethylphenyl)-6-methylpyrimidin-2-yl]amino]propanoic acid (PubChem CID 82192903) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-[[4-(4-ethylphenyl)-6-methylpyrimidin-2-yl]amino]propanoic acid.
| Compound Name | 3-[[4-(4-ethylphenyl)-6-methylpyrimidin-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 82192903 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-[[4-(4-ethylphenyl)-6-methylpyrimidin-2-yl]amino]propanoic acid |
| SMILES | CCc1ccc(-c2cc(C)nc(NCCC(=O)O)n2)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-3-12-4-6-13(7-5-12)14-10-11(2)18-16(19-14)17-9-8-15(20)21/h4-7,10H,3,8-9H2,1-2H3,(H,20,21)(H,17,18,19) |
| InChIKey | QSFAHFBQEZNNGI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |