C15H17N3O2S — CID 82194064
N-(5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-4-phenoxybutanamide (PubChem CID 82194064) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-4-phenoxybutanamide.
| Compound Name | N-(5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-4-phenoxybutanamide |
|---|---|
| PubChem CID | 82194064 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)Nc1nc2c(s1)CNC2 |
| InChI | InChI=1S/C15H17N3O2S/c19-14(7-4-8-20-11-5-2-1-3-6-11)18-15-17-12-9-16-10-13(12)21-15/h1-3,5-6,16H,4,7-10H2,(H,17,18,19) |
| InChIKey | VJOVXLSKLJHYMC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|