5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid

C11H9N3O5 — CID 82195503

IUPAC5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)cc(-n2cc(CO)nn2)c1
InChIInChI=1S/C11H9N3O5/c15-5-8-4-14(13-12-8)9-2-6(10(16)17)1-7(3-9)11(18)19/h1-4,15H,5H2,(H,16,17)(H,18,19)
InChIKeyRLHNUYNXMJEIBD-UHFFFAOYSA-N
MW263.21 g/mol
LogP0.16
Rot. Bonds4

About 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid

5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid (PubChem CID 82195503) has the molecular formula C11H9N3O5 and a molecular weight of 263.21 g/mol. Its IUPAC name is 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid
PubChem CID82195503
Molecular FormulaC11H9N3O5
Molecular Weight263.21 g/mol
Exact Mass263.05
IUPAC Name5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)cc(-n2cc(CO)nn2)c1
InChIInChI=1S/C11H9N3O5/c15-5-8-4-14(13-12-8)9-2-6(10(16)17)1-7(3-9)11(18)19/h1-4,15H,5H2,(H,16,17)(H,18,19)
InChIKeyRLHNUYNXMJEIBD-UHFFFAOYSA-N
XLogP0.16
TPSA125.54 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.21
LogP ≤ 50.16
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid?
The IUPAC name of 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid (CID 82195503) is 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid?
The canonical SMILES for 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid is O=C(O)c1cc(C(=O)O)cc(-n2cc(CO)nn2)c1.
What is the InChIKey of 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid?
The InChIKey is RLHNUYNXMJEIBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O5/c15-5-8-4-14(13-12-8)9-2-6(10(16)17)1-7(3-9)11(18)19/h1-4,15H,5H2,(H,16,17)(H,18,19).
What are the key properties of 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid?
5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid has a molecular weight of 263.21 g/mol, XLogP of 0.16, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(hydroxymethyl)triazol-1-yl]benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 82195503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).