C13H12Cl2N4 — CID 82196612
5-tert-butyl-1-(3,5-dichlorophenyl)triazole-4-carbonitrile (PubChem CID 82196612) has the molecular formula C13H12Cl2N4 and a molecular weight of 295.17 g/mol. Its IUPAC name is 5-tert-butyl-1-(3,5-dichlorophenyl)triazole-4-carbonitrile.
| Compound Name | 5-tert-butyl-1-(3,5-dichlorophenyl)triazole-4-carbonitrile |
|---|---|
| PubChem CID | 82196612 |
| Molecular Formula | C13H12Cl2N4 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 5-tert-butyl-1-(3,5-dichlorophenyl)triazole-4-carbonitrile |
| SMILES | CC(C)(C)c1c(C#N)nnn1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N4/c1-13(2,3)12-11(7-16)17-18-19(12)10-5-8(14)4-9(15)6-10/h4-6H,1-3H3 |
| InChIKey | IUUJPIYYHIYDLM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |