C14H14N4O3 — CID 82199263
5-(5-tert-butyl-4-cyanotriazol-1-yl)-2-hydroxybenzoic acid (PubChem CID 82199263) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-(5-tert-butyl-4-cyanotriazol-1-yl)-2-hydroxybenzoic acid.
| Compound Name | 5-(5-tert-butyl-4-cyanotriazol-1-yl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 82199263 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-(5-tert-butyl-4-cyanotriazol-1-yl)-2-hydroxybenzoic acid |
| SMILES | CC(C)(C)c1c(C#N)nnn1-c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H14N4O3/c1-14(2,3)12-10(7-15)16-17-18(12)8-4-5-11(19)9(6-8)13(20)21/h4-6,19H,1-3H3,(H,20,21) |
| InChIKey | DIZNZKDAZYXZON-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |