C13H10FN3O4 — CID 82202448
1-(carboxymethyl)-5-[(E)-2-(4-fluorophenyl)ethenyl]triazole-4-carboxylic acid (PubChem CID 82202448) has the molecular formula C13H10FN3O4 and a molecular weight of 291.24 g/mol. Its IUPAC name is 1-(carboxymethyl)-5-[(E)-2-(4-fluorophenyl)ethenyl]triazole-4-carboxylic acid.
| Compound Name | 1-(carboxymethyl)-5-[(E)-2-(4-fluorophenyl)ethenyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82202448 |
| Molecular Formula | C13H10FN3O4 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1-(carboxymethyl)-5-[(E)-2-(4-fluorophenyl)ethenyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)Cn1nnc(C(=O)O)c1/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C13H10FN3O4/c14-9-4-1-8(2-5-9)3-6-10-12(13(20)21)15-16-17(10)7-11(18)19/h1-6H,7H2,(H,18,19)(H,20,21)/b6-3+ |
| InChIKey | DHZAZQUMMFTZHH-ZZXKWVIFSA-N |
| XLogP | 1.37 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |