C15H16ClN3O2 — CID 94943933
1-butyl-5-[(E)-2-(4-chlorophenyl)ethenyl]triazole-4-carboxylic acid (PubChem CID 94943933) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is 1-butyl-5-[(E)-2-(4-chlorophenyl)ethenyl]triazole-4-carboxylic acid.
| Compound Name | 1-butyl-5-[(E)-2-(4-chlorophenyl)ethenyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94943933 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 1-butyl-5-[(E)-2-(4-chlorophenyl)ethenyl]triazole-4-carboxylic acid |
| SMILES | CCCCn1nnc(C(=O)O)c1/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN3O2/c1-2-3-10-19-13(14(15(20)21)17-18-19)9-6-11-4-7-12(16)8-5-11/h4-9H,2-3,10H2,1H3,(H,20,21)/b9-6+ |
| InChIKey | PRVPLMUPYXRQFG-RMKNXTFCSA-N |
| XLogP | 3.60 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |