C17H26N4 — CID 82204281
[5-tert-butyl-1-[(4-propan-2-ylphenyl)methyl]triazol-4-yl]methanamine (PubChem CID 82204281) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is [5-tert-butyl-1-[(4-propan-2-ylphenyl)methyl]triazol-4-yl]methanamine.
| Compound Name | [5-tert-butyl-1-[(4-propan-2-ylphenyl)methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82204281 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | [5-tert-butyl-1-[(4-propan-2-ylphenyl)methyl]triazol-4-yl]methanamine |
| SMILES | CC(C)c1ccc(Cn2nnc(CN)c2C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26N4/c1-12(2)14-8-6-13(7-9-14)11-21-16(17(3,4)5)15(10-18)19-20-21/h6-9,12H,10-11,18H2,1-5H3 |
| InChIKey | POYIAXFRKWYXJQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |