C17H20N4S — CID 94943770
[1-[(4-propan-2-ylphenyl)methyl]-5-thiophen-2-yltriazol-4-yl]methanamine (PubChem CID 94943770) has the molecular formula C17H20N4S and a molecular weight of 312.44 g/mol. Its IUPAC name is [1-[(4-propan-2-ylphenyl)methyl]-5-thiophen-2-yltriazol-4-yl]methanamine.
| Compound Name | [1-[(4-propan-2-ylphenyl)methyl]-5-thiophen-2-yltriazol-4-yl]methanamine |
|---|---|
| PubChem CID | 94943770 |
| Molecular Formula | C17H20N4S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [1-[(4-propan-2-ylphenyl)methyl]-5-thiophen-2-yltriazol-4-yl]methanamine |
| SMILES | CC(C)c1ccc(Cn2nnc(CN)c2-c2cccs2)cc1 |
| InChI | InChI=1S/C17H20N4S/c1-12(2)14-7-5-13(6-8-14)11-21-17(15(10-18)19-20-21)16-4-3-9-22-16/h3-9,12H,10-11,18H2,1-2H3 |
| InChIKey | UURORWHFVYAKHE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |