C16H23N3O3 — CID 82205067
[5-[2-(3,4-dimethoxyphenyl)ethyl]-1-propyltriazol-4-yl]methanol (PubChem CID 82205067) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is [5-[2-(3,4-dimethoxyphenyl)ethyl]-1-propyltriazol-4-yl]methanol.
| Compound Name | [5-[2-(3,4-dimethoxyphenyl)ethyl]-1-propyltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 82205067 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | [5-[2-(3,4-dimethoxyphenyl)ethyl]-1-propyltriazol-4-yl]methanol |
| SMILES | CCCn1nnc(CO)c1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H23N3O3/c1-4-9-19-14(13(11-20)17-18-19)7-5-12-6-8-15(21-2)16(10-12)22-3/h6,8,10,20H,4-5,7,9,11H2,1-3H3 |
| InChIKey | DCTBTIWTZHIAOZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |