C15H21N3O3 — CID 82207395
[5-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyltriazol-4-yl]methanol (PubChem CID 82207395) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is [5-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyltriazol-4-yl]methanol.
| Compound Name | [5-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 82207395 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | [5-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyltriazol-4-yl]methanol |
| SMILES | CCn1nnc(CO)c1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-4-18-13(12(10-19)16-17-18)7-5-11-6-8-14(20-2)15(9-11)21-3/h6,8-9,19H,4-5,7,10H2,1-3H3 |
| InChIKey | XWOCNNPRJGSFDP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |