C11H11F3N4 — CID 82207516
[1-ethyl-5-(2,3,4-trifluorophenyl)triazol-4-yl]methanamine (PubChem CID 82207516) has the molecular formula C11H11F3N4 and a molecular weight of 256.23 g/mol. Its IUPAC name is [1-ethyl-5-(2,3,4-trifluorophenyl)triazol-4-yl]methanamine.
| Compound Name | [1-ethyl-5-(2,3,4-trifluorophenyl)triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82207516 |
| Molecular Formula | C11H11F3N4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [1-ethyl-5-(2,3,4-trifluorophenyl)triazol-4-yl]methanamine |
| SMILES | CCn1nnc(CN)c1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H11F3N4/c1-2-18-11(8(5-15)16-17-18)6-3-4-7(12)10(14)9(6)13/h3-4H,2,5,15H2,1H3 |
| InChIKey | MXDLGOGHFFYDEP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|