C12H13F3N4O — CID 82211666
3-[4-(aminomethyl)-5-(2,3,4-trifluorophenyl)triazol-1-yl]propan-1-ol (PubChem CID 82211666) has the molecular formula C12H13F3N4O and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-5-(2,3,4-trifluorophenyl)triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-(aminomethyl)-5-(2,3,4-trifluorophenyl)triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 82211666 |
| Molecular Formula | C12H13F3N4O |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[4-(aminomethyl)-5-(2,3,4-trifluorophenyl)triazol-1-yl]propan-1-ol |
| SMILES | NCc1nnn(CCCO)c1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H13F3N4O/c13-8-3-2-7(10(14)11(8)15)12-9(6-16)17-18-19(12)4-1-5-20/h2-3,20H,1,4-6,16H2 |
| InChIKey | ULQVPYPPWVODAU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|