C13H11F2N3O2 — CID 82210621
5-(3,4-difluorophenyl)-1-(2-methylprop-2-enyl)triazole-4-carboxylic acid (PubChem CID 82210621) has the molecular formula C13H11F2N3O2 and a molecular weight of 279.25 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-1-(2-methylprop-2-enyl)triazole-4-carboxylic acid.
| Compound Name | 5-(3,4-difluorophenyl)-1-(2-methylprop-2-enyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82210621 |
| Molecular Formula | C13H11F2N3O2 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-(3,4-difluorophenyl)-1-(2-methylprop-2-enyl)triazole-4-carboxylic acid |
| SMILES | C=C(C)Cn1nnc(C(=O)O)c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H11F2N3O2/c1-7(2)6-18-12(11(13(19)20)16-17-18)8-3-4-9(14)10(15)5-8/h3-5H,1,6H2,2H3,(H,19,20) |
| InChIKey | XCDCKOSQGGVJGA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|