C13H18ClNO3 — CID 82215210
2-[[2-(1,3-benzodioxol-5-yl)-2-chloroethyl]-ethylamino]ethanol (PubChem CID 82215210) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-yl)-2-chloroethyl]-ethylamino]ethanol.
| Compound Name | 2-[[2-(1,3-benzodioxol-5-yl)-2-chloroethyl]-ethylamino]ethanol |
|---|---|
| PubChem CID | 82215210 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-yl)-2-chloroethyl]-ethylamino]ethanol |
| SMILES | CCN(CCO)CC(Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H18ClNO3/c1-2-15(5-6-16)8-11(14)10-3-4-12-13(7-10)18-9-17-12/h3-4,7,11,16H,2,5-6,8-9H2,1H3 |
| InChIKey | BQQCSNFBCVLDQM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|