C16H27N3O4 — CID 82218616
2-[[1-[3-(diethylamino)propyl]-5-hydroxy-4-oxo-2-pyridinyl]methyl-methylamino]acetic acid (PubChem CID 82218616) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[[1-[3-(diethylamino)propyl]-5-hydroxy-4-oxo-2-pyridinyl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[1-[3-(diethylamino)propyl]-5-hydroxy-4-oxo-2-pyridinyl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 82218616 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-[[1-[3-(diethylamino)propyl]-5-hydroxy-4-oxo-2-pyridinyl]methyl-methylamino]acetic acid |
| SMILES | CCN(CC)CCCn1cc(O)c(=O)cc1CN(C)CC(=O)O |
| InChI | InChI=1S/C16H27N3O4/c1-4-18(5-2)7-6-8-19-11-15(21)14(20)9-13(19)10-17(3)12-16(22)23/h9,11,21H,4-8,10,12H2,1-3H3,(H,22,23) |
| InChIKey | DGPYWQFMGZKJHO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |