C16H29N3O4 — CID 82218890
2-[[bis(2-methoxyethyl)amino]methyl]-1-[2-(dimethylamino)ethyl]-5-hydroxypyridin-4-one (PubChem CID 82218890) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[[bis(2-methoxyethyl)amino]methyl]-1-[2-(dimethylamino)ethyl]-5-hydroxypyridin-4-one.
| Compound Name | 2-[[bis(2-methoxyethyl)amino]methyl]-1-[2-(dimethylamino)ethyl]-5-hydroxypyridin-4-one |
|---|---|
| PubChem CID | 82218890 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 2-[[bis(2-methoxyethyl)amino]methyl]-1-[2-(dimethylamino)ethyl]-5-hydroxypyridin-4-one |
| SMILES | COCCN(CCOC)Cc1cc(=O)c(O)cn1CCN(C)C |
| InChI | InChI=1S/C16H29N3O4/c1-17(2)5-6-19-13-16(21)15(20)11-14(19)12-18(7-9-22-3)8-10-23-4/h11,13,21H,5-10,12H2,1-4H3 |
| InChIKey | OWRNJLWMPSOBDK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |