C18H33N3O2 — CID 82218872
1-[4-(dimethylamino)butyl]-2-[(dipropylamino)methyl]-5-hydroxypyridin-4-one (PubChem CID 82218872) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 1-[4-(dimethylamino)butyl]-2-[(dipropylamino)methyl]-5-hydroxypyridin-4-one.
| Compound Name | 1-[4-(dimethylamino)butyl]-2-[(dipropylamino)methyl]-5-hydroxypyridin-4-one |
|---|---|
| PubChem CID | 82218872 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 1-[4-(dimethylamino)butyl]-2-[(dipropylamino)methyl]-5-hydroxypyridin-4-one |
| SMILES | CCCN(CCC)Cc1cc(=O)c(O)cn1CCCCN(C)C |
| InChI | InChI=1S/C18H33N3O2/c1-5-9-20(10-6-2)14-16-13-17(22)18(23)15-21(16)12-8-7-11-19(3)4/h13,15,23H,5-12,14H2,1-4H3 |
| InChIKey | LBUGAUJPHPMGMV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|