C14H12N2O4 — CID 82220379
6-(2-hydroxyethoxy)-9H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 82220379) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 6-(2-hydroxyethoxy)-9H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 6-(2-hydroxyethoxy)-9H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 82220379 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 6-(2-hydroxyethoxy)-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)c1cc2c(cn1)[nH]c1ccc(OCCO)cc12 |
| InChI | InChI=1S/C14H12N2O4/c17-3-4-20-8-1-2-11-9(5-8)10-6-12(14(18)19)15-7-13(10)16-11/h1-2,5-7,16-17H,3-4H2,(H,18,19) |
| InChIKey | RUOYPRISBCABFI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |