C17H19N3O2 — CID 11833410
N-tert-butyl-6-methoxy-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 11833410) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-tert-butyl-6-methoxy-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | N-tert-butyl-6-methoxy-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 11833410 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-tert-butyl-6-methoxy-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COc1ccc2[nH]c3cnc(C(=O)NC(C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C17H19N3O2/c1-17(2,3)20-16(21)14-8-12-11-7-10(22-4)5-6-13(11)19-15(12)9-18-14/h5-9,19H,1-4H3,(H,20,21) |
| InChIKey | HTCLTVTYRYUPOG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |