C11H15N5O2S — CID 82221565
5-tert-butyl-1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]triazole-4-carbaldehyde (PubChem CID 82221565) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 5-tert-butyl-1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]triazole-4-carbaldehyde.
| Compound Name | 5-tert-butyl-1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82221565 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 5-tert-butyl-1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]triazole-4-carbaldehyde |
| SMILES | COCc1nnc(-n2nnc(C=O)c2C(C)(C)C)s1 |
| InChI | InChI=1S/C11H15N5O2S/c1-11(2,3)9-7(5-17)12-15-16(9)10-14-13-8(19-10)6-18-4/h5H,6H2,1-4H3 |
| InChIKey | ANXOYJRQLMLXEA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|