C10H15ClN2 — CID 82225111
6-chloro-N,N-diethyl-2-methylpyridin-3-amine (PubChem CID 82225111) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is 6-chloro-N,N-diethyl-2-methylpyridin-3-amine.
| Compound Name | 6-chloro-N,N-diethyl-2-methylpyridin-3-amine |
|---|---|
| PubChem CID | 82225111 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 6-chloro-N,N-diethyl-2-methylpyridin-3-amine |
| SMILES | CCN(CC)c1ccc(Cl)nc1C |
| InChI | InChI=1S/C10H15ClN2/c1-4-13(5-2)9-6-7-10(11)12-8(9)3/h6-7H,4-5H2,1-3H3 |
| InChIKey | XPWKHCJDADGSET-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|