C12H20N2 — CID 137454307
N-ethyl-2,6-dimethyl-N-propylpyridin-3-amine (PubChem CID 137454307) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-ethyl-2,6-dimethyl-N-propylpyridin-3-amine.
| Compound Name | N-ethyl-2,6-dimethyl-N-propylpyridin-3-amine |
|---|---|
| PubChem CID | 137454307 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-ethyl-2,6-dimethyl-N-propylpyridin-3-amine |
| SMILES | CCCN(CC)c1ccc(C)nc1C |
| InChI | InChI=1S/C12H20N2/c1-5-9-14(6-2)12-8-7-10(3)13-11(12)4/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | YAQNJOWFZKLNRG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |