C14H14ClNO — CID 82225212
2-chloro-5-(3,5-dimethylphenoxy)-3-methylpyridine (PubChem CID 82225212) has the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. Its IUPAC name is 2-chloro-5-(3,5-dimethylphenoxy)-3-methylpyridine.
| Compound Name | 2-chloro-5-(3,5-dimethylphenoxy)-3-methylpyridine |
|---|---|
| PubChem CID | 82225212 |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-chloro-5-(3,5-dimethylphenoxy)-3-methylpyridine |
| SMILES | Cc1cc(C)cc(Oc2cnc(Cl)c(C)c2)c1 |
| InChI | InChI=1S/C14H14ClNO/c1-9-4-10(2)6-12(5-9)17-13-7-11(3)14(15)16-8-13/h4-8H,1-3H3 |
| InChIKey | KNZQELSKOUVMHJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|