C10H8ClNO4 — CID 82228548
2-(4-chloro-3-nitrophenyl)cyclopropane-1-carboxylic acid (PubChem CID 82228548) has the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. Its IUPAC name is 2-(4-chloro-3-nitrophenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2-(4-chloro-3-nitrophenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 82228548 |
| Molecular Formula | C10H8ClNO4 |
| Molecular Weight | 241.63 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 2-(4-chloro-3-nitrophenyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H8ClNO4/c11-8-2-1-5(3-9(8)12(15)16)6-4-7(6)10(13)14/h1-3,6-7H,4H2,(H,13,14) |
| InChIKey | FMGNDRLDCYYQTA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.63 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|