C13H12ClN3O4S — CID 57110147
4-(4-chloro-3-nitrophenyl)-3,6-dimethyl-2-sulfanylidene-4,5-dihydropyrimidine-5-carboxylic acid (PubChem CID 57110147) has the molecular formula C13H12ClN3O4S and a molecular weight of 341.78 g/mol. Its IUPAC name is 4-(4-chloro-3-nitrophenyl)-3,6-dimethyl-2-sulfanylidene-4,5-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 4-(4-chloro-3-nitrophenyl)-3,6-dimethyl-2-sulfanylidene-4,5-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 57110147 |
| Molecular Formula | C13H12ClN3O4S |
| Molecular Weight | 341.78 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-(4-chloro-3-nitrophenyl)-3,6-dimethyl-2-sulfanylidene-4,5-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=NC(=S)N(C)C(c2ccc(Cl)c([N+](=O)[O-])c2)C1C(=O)O |
| InChI | InChI=1S/C13H12ClN3O4S/c1-6-10(12(18)19)11(16(2)13(22)15-6)7-3-4-8(14)9(5-7)17(20)21/h3-5,10-11H,1-2H3,(H,18,19) |
| InChIKey | MFNXGVMGVRSTHJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.78 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|