C15H18ClNO4 — CID 174373100
5-(4-chloro-3-nitrophenyl)bicyclo[2.1.0]pentane;methyl propanoate (PubChem CID 174373100) has the molecular formula C15H18ClNO4 and a molecular weight of 311.77 g/mol. Its IUPAC name is 5-(4-chloro-3-nitrophenyl)bicyclo[2.1.0]pentane;methyl propanoate.
| Compound Name | 5-(4-chloro-3-nitrophenyl)bicyclo[2.1.0]pentane;methyl propanoate |
|---|---|
| PubChem CID | 174373100 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5-(4-chloro-3-nitrophenyl)bicyclo[2.1.0]pentane;methyl propanoate |
| SMILES | CCC(=O)OC.O=[N+]([O-])c1cc(C2C3CCC32)ccc1Cl |
| InChI | InChI=1S/C11H10ClNO2.C4H8O2/c12-9-4-1-6(5-10(9)13(14)15)11-7-2-3-8(7)11;1-3-4(5)6-2/h1,4-5,7-8,11H,2-3H2;3H2,1-2H3 |
| InChIKey | FMPOYXKPPNWNIE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|