C15H12Cl2N2O2 — CID 82228611
6-amino-2-[(2,3-dichlorophenyl)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 82228611) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is 6-amino-2-[(2,3-dichlorophenyl)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-2-[(2,3-dichlorophenyl)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82228611 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 6-amino-2-[(2,3-dichlorophenyl)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)NC(=O)C(Cc1cccc(Cl)c1Cl)O2 |
| InChI | InChI=1S/C15H12Cl2N2O2/c16-10-3-1-2-8(14(10)17)6-13-15(20)19-11-7-9(18)4-5-12(11)21-13/h1-5,7,13H,6,18H2,(H,19,20) |
| InChIKey | GAIOIWOWRLXRNM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|