C17H17NO3 — CID 82228664
2-[(2,3-dimethylphenyl)methyl]-7-hydroxy-4H-1,4-benzoxazin-3-one (PubChem CID 82228664) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenyl)methyl]-7-hydroxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-[(2,3-dimethylphenyl)methyl]-7-hydroxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82228664 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[(2,3-dimethylphenyl)methyl]-7-hydroxy-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc(CC2Oc3cc(O)ccc3NC2=O)c1C |
| InChI | InChI=1S/C17H17NO3/c1-10-4-3-5-12(11(10)2)8-16-17(20)18-14-7-6-13(19)9-15(14)21-16/h3-7,9,16,19H,8H2,1-2H3,(H,18,20) |
| InChIKey | SEPSAPORUCLVLA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|