C15H13ClN2O2 — CID 82228656
7-amino-2-[(3-chlorophenyl)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 82228656) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 7-amino-2-[(3-chlorophenyl)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-2-[(3-chlorophenyl)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82228656 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 7-amino-2-[(3-chlorophenyl)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)OC(Cc1cccc(Cl)c1)C(=O)N2 |
| InChI | InChI=1S/C15H13ClN2O2/c16-10-3-1-2-9(6-10)7-14-15(19)18-12-5-4-11(17)8-13(12)20-14/h1-6,8,14H,7,17H2,(H,18,19) |
| InChIKey | BWKIPQFFMLWAJN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|