C17H14ClN3O2 — CID 82229052
2-[6-amino-2-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-4-yl]acetonitrile (PubChem CID 82229052) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is 2-[6-amino-2-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-4-yl]acetonitrile.
| Compound Name | 2-[6-amino-2-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 82229052 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[6-amino-2-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-4-yl]acetonitrile |
| SMILES | N#CCN1C(=O)C(Cc2cccc(Cl)c2)Oc2ccc(N)cc21 |
| InChI | InChI=1S/C17H14ClN3O2/c18-12-3-1-2-11(8-12)9-16-17(22)21(7-6-19)14-10-13(20)4-5-15(14)23-16/h1-5,8,10,16H,7,9,20H2 |
| InChIKey | NBQMGSXDAMXEGP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|