C13H17NO3 — CID 82231715
5,6-dimethoxy-2-(2-methylpropyl)-1,3-benzoxazole (PubChem CID 82231715) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 5,6-dimethoxy-2-(2-methylpropyl)-1,3-benzoxazole.
| Compound Name | 5,6-dimethoxy-2-(2-methylpropyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 82231715 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 5,6-dimethoxy-2-(2-methylpropyl)-1,3-benzoxazole |
| SMILES | COc1cc2nc(CC(C)C)oc2cc1OC |
| InChI | InChI=1S/C13H17NO3/c1-8(2)5-13-14-9-6-11(15-3)12(16-4)7-10(9)17-13/h6-8H,5H2,1-4H3 |
| InChIKey | XLVXFMFQYGHGBH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |