C16H22BNO4 — CID 168978098
2-ethyl-5-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole (PubChem CID 168978098) has the molecular formula C16H22BNO4 and a molecular weight of 303.17 g/mol. Its IUPAC name is 2-ethyl-5-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole.
| Compound Name | 2-ethyl-5-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 168978098 |
| Molecular Formula | C16H22BNO4 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-ethyl-5-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
| SMILES | CCc1nc2cc(OC)c(B3OC(C)(C)C(C)(C)O3)cc2o1 |
| InChI | InChI=1S/C16H22BNO4/c1-7-14-18-11-9-12(19-6)10(8-13(11)20-14)17-21-15(2,3)16(4,5)22-17/h8-9H,7H2,1-6H3 |
| InChIKey | DUJLDXXCZZMHFB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|