C8H9N3O2S — CID 82240600
2-[(3-carbamimidoyl-2-pyridinyl)sulfanyl]acetic acid (PubChem CID 82240600) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is 2-[(3-carbamimidoyl-2-pyridinyl)sulfanyl]acetic acid.
| Compound Name | 2-[(3-carbamimidoyl-2-pyridinyl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 82240600 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-[(3-carbamimidoyl-2-pyridinyl)sulfanyl]acetic acid |
| SMILES | [H]/N=C(\N)c1cccnc1SCC(=O)O |
| InChI | InChI=1S/C8H9N3O2S/c9-7(10)5-2-1-3-11-8(5)14-4-6(12)13/h1-3H,4H2,(H3,9,10)(H,12,13) |
| InChIKey | OEAOMXRBVCRWAV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|