C8H18N2O2S — CID 82241466
2,2,5-trimethyl-1-methylsulfonylpiperazine (PubChem CID 82241466) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2,2,5-trimethyl-1-methylsulfonylpiperazine.
| Compound Name | 2,2,5-trimethyl-1-methylsulfonylpiperazine |
|---|---|
| PubChem CID | 82241466 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2,2,5-trimethyl-1-methylsulfonylpiperazine |
| SMILES | CC1CN(S(C)(=O)=O)C(C)(C)CN1 |
| InChI | InChI=1S/C8H18N2O2S/c1-7-5-10(13(4,11)12)8(2,3)6-9-7/h7,9H,5-6H2,1-4H3 |
| InChIKey | JCFCHYLDUZIQEX-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |