2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid

C12H14N2O3 — CID 82243185

IUPAC2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid
SMILESCC(Oc1ccccc1C1=NCCN1)C(=O)O
InChIInChI=1S/C12H14N2O3/c1-8(12(15)16)17-10-5-3-2-4-9(10)11-13-6-7-14-11/h2-5,8H,6-7H2,1H3,(H,13,14)(H,15,16)
InChIKeyTVZUSISPEBHVBQ-UHFFFAOYSA-N
MW234.25 g/mol
LogP0.89
Rot. Bonds4

About 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid

2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid (PubChem CID 82243185) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid.

Molecular Properties

Compound Name2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid
PubChem CID82243185
Molecular FormulaC12H14N2O3
Molecular Weight234.25 g/mol
Exact Mass234.10
IUPAC Name2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid
SMILESCC(Oc1ccccc1C1=NCCN1)C(=O)O
InChIInChI=1S/C12H14N2O3/c1-8(12(15)16)17-10-5-3-2-4-9(10)11-13-6-7-14-11/h2-5,8H,6-7H2,1H3,(H,13,14)(H,15,16)
InChIKeyTVZUSISPEBHVBQ-UHFFFAOYSA-N
XLogP0.89
TPSA70.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.25
LogP ≤ 50.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid?
The IUPAC name of 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid (CID 82243185) is 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid.
What is the SMILES notation for 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid?
The canonical SMILES for 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid is CC(Oc1ccccc1C1=NCCN1)C(=O)O.
What is the InChIKey of 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid?
The InChIKey is TVZUSISPEBHVBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3/c1-8(12(15)16)17-10-5-3-2-4-9(10)11-13-6-7-14-11/h2-5,8H,6-7H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid?
2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid has a molecular weight of 234.25 g/mol, XLogP of 0.89, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]propanoic acid is sourced from PubChem (CID 82243185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).