C18H20N2O — CID 82249041
2-[2-(2,3,6-trimethylphenoxy)phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 82249041) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[2-(2,3,6-trimethylphenoxy)phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[2-(2,3,6-trimethylphenoxy)phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 82249041 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-[2-(2,3,6-trimethylphenoxy)phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | Cc1ccc(C)c(Oc2ccccc2C2=NCCN2)c1C |
| InChI | InChI=1S/C18H20N2O/c1-12-8-9-13(2)17(14(12)3)21-16-7-5-4-6-15(16)18-19-10-11-20-18/h4-9H,10-11H2,1-3H3,(H,19,20) |
| InChIKey | YKZQKSPSFBFFHO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |