C14H15NO5 — CID 82248592
2-[1-(2-hydroxyethyl)-7-methoxy-4-oxoquinolin-2-yl]acetic acid (PubChem CID 82248592) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[1-(2-hydroxyethyl)-7-methoxy-4-oxoquinolin-2-yl]acetic acid.
| Compound Name | 2-[1-(2-hydroxyethyl)-7-methoxy-4-oxoquinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 82248592 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-[1-(2-hydroxyethyl)-7-methoxy-4-oxoquinolin-2-yl]acetic acid |
| SMILES | COc1ccc2c(=O)cc(CC(=O)O)n(CCO)c2c1 |
| InChI | InChI=1S/C14H15NO5/c1-20-10-2-3-11-12(8-10)15(4-5-16)9(6-13(11)17)7-14(18)19/h2-3,6,8,16H,4-5,7H2,1H3,(H,18,19) |
| InChIKey | MLRBXJHULBZZEI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |