C12H7Cl3N2 — CID 82249844
3-(5,6,8-trichloroquinolin-2-yl)propanenitrile (PubChem CID 82249844) has the molecular formula C12H7Cl3N2 and a molecular weight of 285.56 g/mol. Its IUPAC name is 3-(5,6,8-trichloroquinolin-2-yl)propanenitrile.
| Compound Name | 3-(5,6,8-trichloroquinolin-2-yl)propanenitrile |
|---|---|
| PubChem CID | 82249844 |
| Molecular Formula | C12H7Cl3N2 |
| Molecular Weight | 285.56 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 3-(5,6,8-trichloroquinolin-2-yl)propanenitrile |
| SMILES | N#CCCc1ccc2c(Cl)c(Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C12H7Cl3N2/c13-9-6-10(14)12-8(11(9)15)4-3-7(17-12)2-1-5-16/h3-4,6H,1-2H2 |
| InChIKey | SZPUEQILQKYETG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|