About 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid
1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid (PubChem CID 82260369) has the molecular formula C19H28N2O3
and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid |
| PubChem CID | 82260369 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid |
| SMILES | CC(C)(C)C(=O)Nc1ccc(CCN2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-19(2,3)18(24)20-16-6-4-14(5-7-16)8-11-21-12-9-15(10-13-21)17(22)23/h4-7,15H,8-13H2,1-3H3,(H,20,24)(H,22,23) |
| InChIKey | AAZIIYDWYJLVDV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid?
The IUPAC name of 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid (CID 82260369) is 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid?
The canonical SMILES for 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid is CC(C)(C)C(=O)Nc1ccc(CCN2CCC(C(=O)O)CC2)cc1.
What is the InChIKey of 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid?
The InChIKey is AAZIIYDWYJLVDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O3/c1-19(2,3)18(24)20-16-6-4-14(5-7-16)8-11-21-12-9-15(10-13-21)17(22)23/h4-7,15H,8-13H2,1-3H3,(H,20,24)(H,22,23).
What are the key properties of 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid?
1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid has a molecular weight of 332.44 g/mol, XLogP of 3.01, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[4-(2,2-dimethylpropanoylamino)phenyl]ethyl]piperidine-4-carboxylic acid is sourced from PubChem (CID 82260369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).