C15H22N2O2 — CID 82261461
2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-(oxolan-2-ylmethyl)ethanamine (PubChem CID 82261461) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-(oxolan-2-ylmethyl)ethanamine.
| Compound Name | 2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-(oxolan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 82261461 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-(oxolan-2-ylmethyl)ethanamine |
| SMILES | c1cc2c(cc1CCNCC1CCCO1)NCCO2 |
| InChI | InChI=1S/C15H22N2O2/c1-2-13(18-8-1)11-16-6-5-12-3-4-15-14(10-12)17-7-9-19-15/h3-4,10,13,16-17H,1-2,5-9,11H2 |
| InChIKey | RXWOEZLHPXNBOH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|