C19H28N2O — CID 82261539
2-(cyclohexen-1-yl)-N-[2-(2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)ethyl]ethanamine (PubChem CID 82261539) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[2-(2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)ethyl]ethanamine.
| Compound Name | 2-(cyclohexen-1-yl)-N-[2-(2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 82261539 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[2-(2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)ethyl]ethanamine |
| SMILES | CC1CNc2cc(CCNCCC3=CCCCC3)ccc2O1 |
| InChI | InChI=1S/C19H28N2O/c1-15-14-21-18-13-17(7-8-19(18)22-15)10-12-20-11-9-16-5-3-2-4-6-16/h5,7-8,13,15,20-21H,2-4,6,9-12,14H2,1H3 |
| InChIKey | CZQQCTQTTKPDHZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|