C18H28N2O2 — CID 82261734
1-(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)-2-(hexylamino)ethanone (PubChem CID 82261734) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)-2-(hexylamino)ethanone.
| Compound Name | 1-(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)-2-(hexylamino)ethanone |
|---|---|
| PubChem CID | 82261734 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)-2-(hexylamino)ethanone |
| SMILES | CCCCCCNCC(=O)c1ccc2c(c1)NCC(C)(C)O2 |
| InChI | InChI=1S/C18H28N2O2/c1-4-5-6-7-10-19-12-16(21)14-8-9-17-15(11-14)20-13-18(2,3)22-17/h8-9,11,19-20H,4-7,10,12-13H2,1-3H3 |
| InChIKey | UEOCGQDGTUHNMU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|