C19H26N2O — CID 82263132
2-methyl-1-(4-methylnaphthalen-1-yl)-3-piperazin-1-ylpropan-1-ol (PubChem CID 82263132) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-methyl-1-(4-methylnaphthalen-1-yl)-3-piperazin-1-ylpropan-1-ol.
| Compound Name | 2-methyl-1-(4-methylnaphthalen-1-yl)-3-piperazin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 82263132 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 2-methyl-1-(4-methylnaphthalen-1-yl)-3-piperazin-1-ylpropan-1-ol |
| SMILES | Cc1ccc(C(O)C(C)CN2CCNCC2)c2ccccc12 |
| InChI | InChI=1S/C19H26N2O/c1-14-7-8-18(17-6-4-3-5-16(14)17)19(22)15(2)13-21-11-9-20-10-12-21/h3-8,15,19-20,22H,9-13H2,1-2H3 |
| InChIKey | OMLIDYZSRABKMG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |