C14H15ClN2 — CID 82268977
2-chloro-6,7-dimethyl-1-propylindole-3-carbonitrile (PubChem CID 82268977) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 2-chloro-6,7-dimethyl-1-propylindole-3-carbonitrile.
| Compound Name | 2-chloro-6,7-dimethyl-1-propylindole-3-carbonitrile |
|---|---|
| PubChem CID | 82268977 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-chloro-6,7-dimethyl-1-propylindole-3-carbonitrile |
| SMILES | CCCn1c(Cl)c(C#N)c2ccc(C)c(C)c21 |
| InChI | InChI=1S/C14H15ClN2/c1-4-7-17-13-10(3)9(2)5-6-11(13)12(8-16)14(17)15/h5-6H,4,7H2,1-3H3 |
| InChIKey | AGEFEKGNALDFLD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |