C13H15Cl2NO — CID 82269358
(1-butyl-2,7-dichloroindol-3-yl)methanol (PubChem CID 82269358) has the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. Its IUPAC name is (1-butyl-2,7-dichloroindol-3-yl)methanol.
| Compound Name | (1-butyl-2,7-dichloroindol-3-yl)methanol |
|---|---|
| PubChem CID | 82269358 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (1-butyl-2,7-dichloroindol-3-yl)methanol |
| SMILES | CCCCn1c(Cl)c(CO)c2cccc(Cl)c21 |
| InChI | InChI=1S/C13H15Cl2NO/c1-2-3-7-16-12-9(5-4-6-11(12)14)10(8-17)13(16)15/h4-6,17H,2-3,7-8H2,1H3 |
| InChIKey | WUFQJKPKHOCQCB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |