C11H10Cl3NO — CID 82269557
(2,5,6-trichloro-1-ethylindol-3-yl)methanol (PubChem CID 82269557) has the molecular formula C11H10Cl3NO and a molecular weight of 278.57 g/mol. Its IUPAC name is (2,5,6-trichloro-1-ethylindol-3-yl)methanol.
| Compound Name | (2,5,6-trichloro-1-ethylindol-3-yl)methanol |
|---|---|
| PubChem CID | 82269557 |
| Molecular Formula | C11H10Cl3NO |
| Molecular Weight | 278.57 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | (2,5,6-trichloro-1-ethylindol-3-yl)methanol |
| SMILES | CCn1c(Cl)c(CO)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C11H10Cl3NO/c1-2-15-10-4-9(13)8(12)3-6(10)7(5-16)11(15)14/h3-4,16H,2,5H2,1H3 |
| InChIKey | UOOPABBNECYTIR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |