C10H10F3N3S — CID 82270139
2-propan-2-yl-5-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione (PubChem CID 82270139) has the molecular formula C10H10F3N3S and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-propan-2-yl-5-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
| Compound Name | 2-propan-2-yl-5-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
|---|---|
| PubChem CID | 82270139 |
| Molecular Formula | C10H10F3N3S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-propan-2-yl-5-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| SMILES | CC(C)c1cc2nc(C(F)(F)F)cc(=S)n2[nH]1 |
| InChI | InChI=1S/C10H10F3N3S/c1-5(2)6-3-8-14-7(10(11,12)13)4-9(17)16(8)15-6/h3-5,15H,1-2H3 |
| InChIKey | KKYWCZCXEZBXPI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|