C8H6F3N3S — CID 82270038
5-methyl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione (PubChem CID 82270038) has the molecular formula C8H6F3N3S and a molecular weight of 233.22 g/mol. Its IUPAC name is 5-methyl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
| Compound Name | 5-methyl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
|---|---|
| PubChem CID | 82270038 |
| Molecular Formula | C8H6F3N3S |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 5-methyl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| SMILES | Cc1cc(=S)n2[nH]c(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C8H6F3N3S/c1-4-2-7(15)14-6(12-4)3-5(13-14)8(9,10)11/h2-3,13H,1H3 |
| InChIKey | UEQJWQQXDNNFFX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|