C9H8F3N3S — CID 82270077
5-ethyl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione (PubChem CID 82270077) has the molecular formula C9H8F3N3S and a molecular weight of 247.24 g/mol. Its IUPAC name is 5-ethyl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
| Compound Name | 5-ethyl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
|---|---|
| PubChem CID | 82270077 |
| Molecular Formula | C9H8F3N3S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 5-ethyl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| SMILES | CCc1cc(=S)n2[nH]c(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C9H8F3N3S/c1-2-5-3-8(16)15-7(13-5)4-6(14-15)9(10,11)12/h3-4,14H,2H2,1H3 |
| InChIKey | VKLHOSIIOHZELQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|